C30H46O7Si — CID 132938512
2-[(2S,3R,5R)-5-[(1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-bis(methoxymethoxy)propyl]-3-methyloxolan-2-yl]ethanol (PubChem CID 132938512) has the molecular formula C30H46O7Si and a molecular weight of 546.78 g/mol. Its IUPAC name is 2-[(2S,3R,5R)-5-[(1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-bis(methoxymethoxy)propyl]-3-methyloxolan-2-yl]ethanol.
| Compound Name | 2-[(2S,3R,5R)-5-[(1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-bis(methoxymethoxy)propyl]-3-methyloxolan-2-yl]ethanol |
|---|---|
| PubChem CID | 132938512 |
| Molecular Formula | C30H46O7Si |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | 2-[(2S,3R,5R)-5-[(1S,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-bis(methoxymethoxy)propyl]-3-methyloxolan-2-yl]ethanol |
| SMILES | COCO[C@H]([C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOC)[C@H]1C[C@@H](C)[C@H](CCO)O1 |
| InChI | InChI=1S/C30H46O7Si/c1-23-19-27(37-26(23)17-18-31)29(35-22-33-6)28(34-21-32-5)20-36-38(30(2,3)4,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-16,23,26-29,31H,17-22H2,1-6H3/t23-,26+,27-,28-,29+/m1/s1 |
| InChIKey | GPGUHKJSCYXJGK-MCPFUKIPSA-N |
| XLogP | 3.72 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|