C29H45NO6Si — CID 11432569
tert-butyl N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3-(methoxymethoxy)pentyl]carbamate (PubChem CID 11432569) has the molecular formula C29H45NO6Si and a molecular weight of 531.77 g/mol. Its IUPAC name is tert-butyl N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3-(methoxymethoxy)pentyl]carbamate.
| Compound Name | tert-butyl N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3-(methoxymethoxy)pentyl]carbamate |
|---|---|
| PubChem CID | 11432569 |
| Molecular Formula | C29H45NO6Si |
| Molecular Weight | 531.77 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | tert-butyl N-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3-(methoxymethoxy)pentyl]carbamate |
| SMILES | COCOC(CCNC(=O)OC(C)(C)C)C(CO)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H45NO6Si/c1-28(2,3)36-27(32)30-19-18-26(34-22-33-7)23(20-31)21-35-37(29(4,5)6,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-17,23,26,31H,18-22H2,1-7H3,(H,30,32) |
| InChIKey | IRQQURKHMKVWQT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.77 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|