C33H48N2O4Si — CID 10507180
tert-butyl N-[(3R)-3-[(3aR,7aS)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutyl]carbamate (PubChem CID 10507180) has the molecular formula C33H48N2O4Si and a molecular weight of 564.84 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-[(3aR,7aS)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutyl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-[(3aR,7aS)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutyl]carbamate |
|---|---|
| PubChem CID | 10507180 |
| Molecular Formula | C33H48N2O4Si |
| Molecular Weight | 564.84 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | tert-butyl N-[(3R)-3-[(3aR,7aS)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl]-4-[tert-butyl(diphenyl)silyl]oxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C33H48N2O4Si/c1-32(2,3)39-31(37)34-22-21-26(35-23-25-15-13-14-20-29(25)30(35)36)24-38-40(33(4,5)6,27-16-9-7-10-17-27)28-18-11-8-12-19-28/h7-12,16-19,25-26,29H,13-15,20-24H2,1-6H3,(H,34,37)/t25-,26-,29-/m1/s1 |
| InChIKey | SELLKSXNEAEPDW-WWPJHQMMSA-N |
| XLogP | 5.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.84 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|