C30H41N3O4Si — CID 140879308
tert-butyl N-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-1-pyrimidin-2-ylbutan-2-yl]carbamate (PubChem CID 140879308) has the molecular formula C30H41N3O4Si and a molecular weight of 535.76 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-1-pyrimidin-2-ylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-1-pyrimidin-2-ylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 140879308 |
| Molecular Formula | C30H41N3O4Si |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | tert-butyl N-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-1-pyrimidin-2-ylbutan-2-yl]carbamate |
| SMILES | CO[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](Cc1ncccn1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H41N3O4Si/c1-29(2,3)37-28(34)33-25(21-27-31-19-14-20-32-27)26(35-7)22-36-38(30(4,5)6,23-15-10-8-11-16-23)24-17-12-9-13-18-24/h8-20,25-26H,21-22H2,1-7H3,(H,33,34)/t25-,26-/m0/s1 |
| InChIKey | JAMWSCXIHOYFCS-UIOOFZCWSA-N |
| XLogP | 4.50 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|