C27H38N4O4Si — CID 140879225
tert-butyl N-[(2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-(triazol-2-yl)butan-2-yl]carbamate (PubChem CID 140879225) has the molecular formula C27H38N4O4Si and a molecular weight of 510.71 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-(triazol-2-yl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-(triazol-2-yl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140879225 |
| Molecular Formula | C27H38N4O4Si |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | tert-butyl N-[(2R,3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-1-(triazol-2-yl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cn1nccn1)[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H38N4O4Si/c1-26(2,3)35-25(33)30-23(19-31-28-17-18-29-31)24(32)20-34-36(27(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-18,23-24,32H,19-20H2,1-6H3,(H,30,33)/t23-,24-/m1/s1 |
| InChIKey | CJQPMPUPILTMFG-DNQXCXABSA-N |
| XLogP | 3.11 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|