C26H38O7Si — CID 11071012
(4S,5R)-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)ethyl]-4-(methoxymethoxy)oxolan-2-ol (PubChem CID 11071012) has the molecular formula C26H38O7Si and a molecular weight of 490.67 g/mol. Its IUPAC name is (4S,5R)-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)ethyl]-4-(methoxymethoxy)oxolan-2-ol.
| Compound Name | (4S,5R)-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)ethyl]-4-(methoxymethoxy)oxolan-2-ol |
|---|---|
| PubChem CID | 11071012 |
| Molecular Formula | C26H38O7Si |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (4S,5R)-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(methoxymethoxy)ethyl]-4-(methoxymethoxy)oxolan-2-ol |
| SMILES | COCO[C@H]1CC(O)O[C@H]1[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOC |
| InChI | InChI=1S/C26H38O7Si/c1-26(2,3)34(20-12-8-6-9-13-20,21-14-10-7-11-15-21)32-17-23(31-19-29-5)25-22(30-18-28-4)16-24(27)33-25/h6-15,22-25,27H,16-19H2,1-5H3/t22-,23+,24?,25+/m0/s1 |
| InChIKey | HVGDBBMFSPPTBE-VXNFQKBMSA-N |
| XLogP | 2.65 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|