C30H42O2Si — CID 88877406
(E,4S)-4-[(1R,3S)-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-1,2,2-trimethylcyclopentyl]pent-2-enal (PubChem CID 88877406) has the molecular formula C30H42O2Si and a molecular weight of 462.75 g/mol. Its IUPAC name is (E,4S)-4-[(1R,3S)-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-1,2,2-trimethylcyclopentyl]pent-2-enal.
| Compound Name | (E,4S)-4-[(1R,3S)-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-1,2,2-trimethylcyclopentyl]pent-2-enal |
|---|---|
| PubChem CID | 88877406 |
| Molecular Formula | C30H42O2Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (E,4S)-4-[(1R,3S)-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-1,2,2-trimethylcyclopentyl]pent-2-enal |
| SMILES | C[C@@H](/C=C/C=O)[C@@]1(C)CC[C@@H](CCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C30H42O2Si/c1-24(14-13-23-31)30(6)22-20-25(29(30,4)5)19-21-28(2,3)33(32,26-15-9-7-10-16-26)27-17-11-8-12-18-27/h7-18,23-25,32H,19-22H2,1-6H3/b14-13+/t24-,25+,30+/m0/s1 |
| InChIKey | OTCAPNSPPPICCA-CHKHNQHNSA-N |
| XLogP | 6.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|