C31H46O2Si — CID 70973178
[(1S,2R,3S,4aS,5S,8S,8aR)-1-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-3,5,8-trimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methanol (PubChem CID 70973178) has the molecular formula C31H46O2Si and a molecular weight of 478.79 g/mol. Its IUPAC name is [(1S,2R,3S,4aS,5S,8S,8aR)-1-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-3,5,8-trimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methanol.
| Compound Name | [(1S,2R,3S,4aS,5S,8S,8aR)-1-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-3,5,8-trimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 70973178 |
| Molecular Formula | C31H46O2Si |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | [(1S,2R,3S,4aS,5S,8S,8aR)-1-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-3,5,8-trimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methanol |
| SMILES | C[C@H]1CC[C@H](C)[C@H]2[C@H](CCC(C)(C)[Si](O)(c3ccccc3)c3ccccc3)[C@H](CO)[C@@H](C)C[C@H]21 |
| InChI | InChI=1S/C31H46O2Si/c1-22-16-17-23(2)30-27(29(21-32)24(3)20-28(22)30)18-19-31(4,5)34(33,25-12-8-6-9-13-25)26-14-10-7-11-15-26/h6-15,22-24,27-30,32-33H,16-21H2,1-5H3/t22-,23-,24-,27+,28-,29+,30-/m0/s1 |
| InChIKey | XTVKBYBZSFKTCW-JNMDXBJLSA-N |
| XLogP | 5.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|