C22H31BrOSi — CID 90132778
(9-bromo-2-methylnonan-2-yl)-hydroxy-diphenylsilane (PubChem CID 90132778) has the molecular formula C22H31BrOSi and a molecular weight of 419.48 g/mol. Its IUPAC name is (9-bromo-2-methylnonan-2-yl)-hydroxy-diphenylsilane.
| Compound Name | (9-bromo-2-methylnonan-2-yl)-hydroxy-diphenylsilane |
|---|---|
| PubChem CID | 90132778 |
| Molecular Formula | C22H31BrOSi |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (9-bromo-2-methylnonan-2-yl)-hydroxy-diphenylsilane |
| SMILES | CC(C)(CCCCCCCBr)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H31BrOSi/c1-22(2,18-12-4-3-5-13-19-23)25(24,20-14-8-6-9-15-20)21-16-10-7-11-17-21/h6-11,14-17,24H,3-5,12-13,18-19H2,1-2H3 |
| InChIKey | ZJSGYGLUQQMHQO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|