C15H23BrO2 — CID 54137380
8-bromo-2-methyl-2-phenyloctane-1,1-diol (PubChem CID 54137380) has the molecular formula C15H23BrO2 and a molecular weight of 315.25 g/mol. Its IUPAC name is 8-bromo-2-methyl-2-phenyloctane-1,1-diol.
| Compound Name | 8-bromo-2-methyl-2-phenyloctane-1,1-diol |
|---|---|
| PubChem CID | 54137380 |
| Molecular Formula | C15H23BrO2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 8-bromo-2-methyl-2-phenyloctane-1,1-diol |
| SMILES | CC(CCCCCCBr)(c1ccccc1)C(O)O |
| InChI | InChI=1S/C15H23BrO2/c1-15(14(17)18,11-7-2-3-8-12-16)13-9-5-4-6-10-13/h4-6,9-10,14,17-18H,2-3,7-8,11-12H2,1H3 |
| InChIKey | NYQXZENXVUZCPJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|