C23H35NOSi — CID 70334258
9-[hydroxy(diphenyl)silyl]-9-methyldecan-4-amine (PubChem CID 70334258) has the molecular formula C23H35NOSi and a molecular weight of 369.63 g/mol. Its IUPAC name is 9-[hydroxy(diphenyl)silyl]-9-methyldecan-4-amine.
| Compound Name | 9-[hydroxy(diphenyl)silyl]-9-methyldecan-4-amine |
|---|---|
| PubChem CID | 70334258 |
| Molecular Formula | C23H35NOSi |
| Molecular Weight | 369.63 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 9-[hydroxy(diphenyl)silyl]-9-methyldecan-4-amine |
| SMILES | CCCC(N)CCCCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H35NOSi/c1-4-13-20(24)14-11-12-19-23(2,3)26(25,21-15-7-5-8-16-21)22-17-9-6-10-18-22/h5-10,15-18,20,25H,4,11-14,19,24H2,1-3H3 |
| InChIKey | QHYYMQXOAPFTJW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.63 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|