C24H33IOSi — CID 88918102
hydroxy-(8-iodo-2,6,6-trimethylnon-8-en-2-yl)-diphenylsilane (PubChem CID 88918102) has the molecular formula C24H33IOSi and a molecular weight of 492.52 g/mol. Its IUPAC name is hydroxy-(8-iodo-2,6,6-trimethylnon-8-en-2-yl)-diphenylsilane.
| Compound Name | hydroxy-(8-iodo-2,6,6-trimethylnon-8-en-2-yl)-diphenylsilane |
|---|---|
| PubChem CID | 88918102 |
| Molecular Formula | C24H33IOSi |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | hydroxy-(8-iodo-2,6,6-trimethylnon-8-en-2-yl)-diphenylsilane |
| SMILES | C=C(I)CC(C)(C)CCCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33IOSi/c1-20(25)19-23(2,3)17-12-18-24(4,5)27(26,21-13-8-6-9-14-21)22-15-10-7-11-16-22/h6-11,13-16,26H,1,12,17-19H2,2-5H3 |
| InChIKey | URKQKTCSQNHREV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|