C19H26O2SSi — CID 89193381
5-[hydroxy(diphenyl)silyl]-5-methyl-1-sulfanylhexan-2-ol (PubChem CID 89193381) has the molecular formula C19H26O2SSi and a molecular weight of 346.57 g/mol. Its IUPAC name is 5-[hydroxy(diphenyl)silyl]-5-methyl-1-sulfanylhexan-2-ol.
| Compound Name | 5-[hydroxy(diphenyl)silyl]-5-methyl-1-sulfanylhexan-2-ol |
|---|---|
| PubChem CID | 89193381 |
| Molecular Formula | C19H26O2SSi |
| Molecular Weight | 346.57 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 5-[hydroxy(diphenyl)silyl]-5-methyl-1-sulfanylhexan-2-ol |
| SMILES | CC(C)(CCC(O)CS)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H26O2SSi/c1-19(2,14-13-16(20)15-22)23(21,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,20-22H,13-15H2,1-2H3 |
| InChIKey | ASBJPNLJIAZUAQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|