C20H26OSSi — CID 89032425
6-[hydroxy(diphenyl)silyl]-6-methylhept-1-ene-3-thiol (PubChem CID 89032425) has the molecular formula C20H26OSSi and a molecular weight of 342.58 g/mol. Its IUPAC name is 6-[hydroxy(diphenyl)silyl]-6-methylhept-1-ene-3-thiol.
| Compound Name | 6-[hydroxy(diphenyl)silyl]-6-methylhept-1-ene-3-thiol |
|---|---|
| PubChem CID | 89032425 |
| Molecular Formula | C20H26OSSi |
| Molecular Weight | 342.58 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 6-[hydroxy(diphenyl)silyl]-6-methylhept-1-ene-3-thiol |
| SMILES | C=CC(S)CCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26OSSi/c1-4-17(22)15-16-20(2,3)23(21,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h4-14,17,21-22H,1,15-16H2,2-3H3 |
| InChIKey | XNEKIISHWQXNCL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|