C25H30OSi — CID 70887086
hydroxy-(2-methyl-6-phenylhexan-2-yl)-diphenylsilane (PubChem CID 70887086) has the molecular formula C25H30OSi and a molecular weight of 374.60 g/mol. Its IUPAC name is hydroxy-(2-methyl-6-phenylhexan-2-yl)-diphenylsilane.
| Compound Name | hydroxy-(2-methyl-6-phenylhexan-2-yl)-diphenylsilane |
|---|---|
| PubChem CID | 70887086 |
| Molecular Formula | C25H30OSi |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | hydroxy-(2-methyl-6-phenylhexan-2-yl)-diphenylsilane |
| SMILES | CC(C)(CCCCc1ccccc1)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30OSi/c1-25(2,21-13-12-16-22-14-6-3-7-15-22)27(26,23-17-8-4-9-18-23)24-19-10-5-11-20-24/h3-11,14-15,17-20,26H,12-13,16,21H2,1-2H3 |
| InChIKey | XHMVRKWIZGADKG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|