C62H82O3Si2 — CID 57108762
[11-(4-methoxyphenyl)-2-methylundecan-2-yl]-[[11-(4-methoxyphenyl)-2-methylundecan-2-yl]-diphenylsilyl]oxy-diphenylsilane (PubChem CID 57108762) has the molecular formula C62H82O3Si2 and a molecular weight of 931.51 g/mol. Its IUPAC name is [11-(4-methoxyphenyl)-2-methylundecan-2-yl]-[[11-(4-methoxyphenyl)-2-methylundecan-2-yl]-diphenylsilyl]oxy-diphenylsilane.
| Compound Name | [11-(4-methoxyphenyl)-2-methylundecan-2-yl]-[[11-(4-methoxyphenyl)-2-methylundecan-2-yl]-diphenylsilyl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 57108762 |
| Molecular Formula | C62H82O3Si2 |
| Molecular Weight | 931.51 g/mol |
| Exact Mass | 930.58 |
| IUPAC Name | [11-(4-methoxyphenyl)-2-methylundecan-2-yl]-[[11-(4-methoxyphenyl)-2-methylundecan-2-yl]-diphenylsilyl]oxy-diphenylsilane |
| SMILES | COc1ccc(CCCCCCCCCC(C)(C)[Si](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)CCCCCCCCCc2ccc(OC)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C62H82O3Si2/c1-61(2,51-31-15-11-7-9-13-21-33-53-43-47-55(63-5)48-44-53)66(57-35-23-17-24-36-57,58-37-25-18-26-38-58)65-67(59-39-27-19-28-40-59,60-41-29-20-30-42-60)62(3,4)52-32-16-12-8-10-14-22-34-54-45-49-56(64-6)50-46-54/h17-20,23-30,35-50H,7-16,21-22,31-34,51-52H2,1-6H3 |
| InChIKey | FSDRZKDVEHEMRJ-UHFFFAOYSA-N |
| XLogP | 14.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.51 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|