C50H58O5Si2 — CID 70074975
[4-(3,5-dimethoxyphenyl)-2-methylbutan-2-yl]-[[4-(3,5-dimethoxyphenyl)-2-methylbutan-2-yl]-diphenylsilyl]oxy-diphenylsilane (PubChem CID 70074975) has the molecular formula C50H58O5Si2 and a molecular weight of 795.18 g/mol. Its IUPAC name is [4-(3,5-dimethoxyphenyl)-2-methylbutan-2-yl]-[[4-(3,5-dimethoxyphenyl)-2-methylbutan-2-yl]-diphenylsilyl]oxy-diphenylsilane.
| Compound Name | [4-(3,5-dimethoxyphenyl)-2-methylbutan-2-yl]-[[4-(3,5-dimethoxyphenyl)-2-methylbutan-2-yl]-diphenylsilyl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 70074975 |
| Molecular Formula | C50H58O5Si2 |
| Molecular Weight | 795.18 g/mol |
| Exact Mass | 794.38 |
| IUPAC Name | [4-(3,5-dimethoxyphenyl)-2-methylbutan-2-yl]-[[4-(3,5-dimethoxyphenyl)-2-methylbutan-2-yl]-diphenylsilyl]oxy-diphenylsilane |
| SMILES | COc1cc(CCC(C)(C)[Si](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)CCc2cc(OC)cc(OC)c2)(c2ccccc2)c2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C50H58O5Si2/c1-49(2,31-29-39-33-41(51-5)37-42(34-39)52-6)56(45-21-13-9-14-22-45,46-23-15-10-16-24-46)55-57(47-25-17-11-18-26-47,48-27-19-12-20-28-48)50(3,4)32-30-40-35-43(53-7)38-44(36-40)54-8/h9-28,33-38H,29-32H2,1-8H3 |
| InChIKey | RVVFJEVRFZAVIP-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.18 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|