C14H18O4 — CID 22618855
2-methyl-2-(4-phenylbutyl)propanedioic acid (PubChem CID 22618855) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-methyl-2-(4-phenylbutyl)propanedioic acid.
| Compound Name | 2-methyl-2-(4-phenylbutyl)propanedioic acid |
|---|---|
| PubChem CID | 22618855 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-methyl-2-(4-phenylbutyl)propanedioic acid |
| SMILES | CC(CCCCc1ccccc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18O4/c1-14(12(15)16,13(17)18)10-6-5-9-11-7-3-2-4-8-11/h2-4,7-8H,5-6,9-10H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | UTMLVTCVBGQSOG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|