C29H44O2Si — CID 90132776
(Z)-15-[hydroxy(diphenyl)silyl]-15-methylhexadec-8-en-1-ol (PubChem CID 90132776) has the molecular formula C29H44O2Si and a molecular weight of 452.76 g/mol. Its IUPAC name is (Z)-15-[hydroxy(diphenyl)silyl]-15-methylhexadec-8-en-1-ol.
| Compound Name | (Z)-15-[hydroxy(diphenyl)silyl]-15-methylhexadec-8-en-1-ol |
|---|---|
| PubChem CID | 90132776 |
| Molecular Formula | C29H44O2Si |
| Molecular Weight | 452.76 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | (Z)-15-[hydroxy(diphenyl)silyl]-15-methylhexadec-8-en-1-ol |
| SMILES | CC(C)(CCCCC/C=C\CCCCCCCO)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H44O2Si/c1-29(2,25-19-11-9-7-5-3-4-6-8-10-12-20-26-30)32(31,27-21-15-13-16-22-27)28-23-17-14-18-24-28/h3,5,13-18,21-24,30-31H,4,6-12,19-20,25-26H2,1-2H3/b5-3- |
| InChIKey | UQODEAZNEBHTBX-HYXAFXHYSA-N |
| XLogP | 6.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.76 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|