C14H22OSi — CID 102509286
(E)-6-[dimethyl(phenyl)silyl]hex-5-en-1-ol (PubChem CID 102509286) has the molecular formula C14H22OSi and a molecular weight of 234.41 g/mol. Its IUPAC name is (E)-6-[dimethyl(phenyl)silyl]hex-5-en-1-ol.
| Compound Name | (E)-6-[dimethyl(phenyl)silyl]hex-5-en-1-ol |
|---|---|
| PubChem CID | 102509286 |
| Molecular Formula | C14H22OSi |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (E)-6-[dimethyl(phenyl)silyl]hex-5-en-1-ol |
| SMILES | C[Si](C)(/C=C/CCCCO)c1ccccc1 |
| InChI | InChI=1S/C14H22OSi/c1-16(2,13-9-4-3-8-12-15)14-10-6-5-7-11-14/h5-7,9-11,13,15H,3-4,8,12H2,1-2H3/b13-9+ |
| InChIKey | CTWWKCVXJSPRIH-UKTHLTGXSA-N |
| XLogP | 2.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|