C21H28O3SSi — CID 135050406
6-[dimethyl(phenyl)silyl]hex-5-enyl 4-methylbenzenesulfonate (PubChem CID 135050406) has the molecular formula C21H28O3SSi and a molecular weight of 388.61 g/mol. Its IUPAC name is 6-[dimethyl(phenyl)silyl]hex-5-enyl 4-methylbenzenesulfonate.
| Compound Name | 6-[dimethyl(phenyl)silyl]hex-5-enyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135050406 |
| Molecular Formula | C21H28O3SSi |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 6-[dimethyl(phenyl)silyl]hex-5-enyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCC=C[Si](C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H28O3SSi/c1-19-13-15-20(16-14-19)25(22,23)24-17-9-4-5-10-18-26(2,3)21-11-7-6-8-12-21/h6-8,10-16,18H,4-5,9,17H2,1-3H3 |
| InChIKey | ANQDKPCTWTYPGS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|