C24H33NO2SSi2 — CID 101488130
N-[(Z)-4-[dimethyl(phenyl)silyl]but-3-enyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide (PubChem CID 101488130) has the molecular formula C24H33NO2SSi2 and a molecular weight of 455.77 g/mol. Its IUPAC name is N-[(Z)-4-[dimethyl(phenyl)silyl]but-3-enyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide.
| Compound Name | N-[(Z)-4-[dimethyl(phenyl)silyl]but-3-enyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 101488130 |
| Molecular Formula | C24H33NO2SSi2 |
| Molecular Weight | 455.77 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-[(Z)-4-[dimethyl(phenyl)silyl]but-3-enyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C#C[Si](C)(C)C)CC/C=C\[Si](C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H33NO2SSi2/c1-22-14-16-23(17-15-22)28(26,27)25(19-21-29(2,3)4)18-10-11-20-30(5,6)24-12-8-7-9-13-24/h7-9,11-17,20H,10,18H2,1-6H3/b20-11- |
| InChIKey | NWUMMERGFJREAM-JAIQZWGSSA-N |
| XLogP | 4.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.77 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|