C19H22BrNO2SSi — CID 102177565
N-[(2-bromophenyl)methyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide (PubChem CID 102177565) has the molecular formula C19H22BrNO2SSi and a molecular weight of 436.45 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide.
| Compound Name | N-[(2-bromophenyl)methyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102177565 |
| Molecular Formula | C19H22BrNO2SSi |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-4-methyl-N-(2-trimethylsilylethynyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C#C[Si](C)(C)C)Cc2ccccc2Br)cc1 |
| InChI | InChI=1S/C19H22BrNO2SSi/c1-16-9-11-18(12-10-16)24(22,23)21(13-14-25(2,3)4)15-17-7-5-6-8-19(17)20/h5-12H,15H2,1-4H3 |
| InChIKey | JWYWWNQCYSISGX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|