C29H34N2O4S2Si — CID 138978700
4-methyl-N-[2-[[(4-methylphenyl)sulfonyl-(2-trimethylsilylethynyl)amino]methyl]phenyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 138978700) has the molecular formula C29H34N2O4S2Si and a molecular weight of 566.82 g/mol. Its IUPAC name is 4-methyl-N-[2-[[(4-methylphenyl)sulfonyl-(2-trimethylsilylethynyl)amino]methyl]phenyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[[(4-methylphenyl)sulfonyl-(2-trimethylsilylethynyl)amino]methyl]phenyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 138978700 |
| Molecular Formula | C29H34N2O4S2Si |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 4-methyl-N-[2-[[(4-methylphenyl)sulfonyl-(2-trimethylsilylethynyl)amino]methyl]phenyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccccc1CN(C#C[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H34N2O4S2Si/c1-7-20-31(37(34,35)28-18-14-25(3)15-19-28)29-11-9-8-10-26(29)23-30(21-22-38(4,5)6)36(32,33)27-16-12-24(2)13-17-27/h7-19H,1,20,23H2,2-6H3 |
| InChIKey | ZOPZDRKYNNFBDR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|