C18H21NO2S2 — CID 100515606
N-(2-ethylphenyl)-4-methylsulfanyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 100515606) has the molecular formula C18H21NO2S2 and a molecular weight of 347.51 g/mol. Its IUPAC name is N-(2-ethylphenyl)-4-methylsulfanyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-(2-ethylphenyl)-4-methylsulfanyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 100515606 |
| Molecular Formula | C18H21NO2S2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-(2-ethylphenyl)-4-methylsulfanyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccccc1CC)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C18H21NO2S2/c1-4-14-19(18-9-7-6-8-15(18)5-2)23(20,21)17-12-10-16(22-3)11-13-17/h4,6-13H,1,5,14H2,2-3H3 |
| InChIKey | RGGIKPPEBQVJEO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|