C25H27N3O3S2 — CID 6876899
2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]acetamide (PubChem CID 6876899) has the molecular formula C25H27N3O3S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6876899 |
| Molecular Formula | C25H27N3O3S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 2-(2-ethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]acetamide |
| SMILES | CCc1ccccc1N(CC(=O)N/N=C/c1ccc(SC)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H27N3O3S2/c1-4-21-7-5-6-8-24(21)28(33(30,31)23-15-9-19(2)10-16-23)18-25(29)27-26-17-20-11-13-22(32-3)14-12-20/h5-17H,4,18H2,1-3H3,(H,27,29)/b26-17+ |
| InChIKey | LEWWKCUMXXFBPL-YZSQISJMSA-N |
| XLogP | 4.62 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|