C17H16F3NO2S2 — CID 100516677
4-methylsulfanyl-N-prop-2-enyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 100516677) has the molecular formula C17H16F3NO2S2 and a molecular weight of 387.45 g/mol. Its IUPAC name is 4-methylsulfanyl-N-prop-2-enyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-methylsulfanyl-N-prop-2-enyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100516677 |
| Molecular Formula | C17H16F3NO2S2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 4-methylsulfanyl-N-prop-2-enyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | C=CCN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C17H16F3NO2S2/c1-3-11-21(14-6-4-5-13(12-14)17(18,19)20)25(22,23)16-9-7-15(24-2)8-10-16/h3-10,12H,1,11H2,2H3 |
| InChIKey | YXVMXXOHYXJZLX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|