C23H25F3N2O4S — CID 55984950
3-(3,3-dimethylmorpholine-4-carbonyl)-N-prop-2-enyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 55984950) has the molecular formula C23H25F3N2O4S and a molecular weight of 482.52 g/mol. Its IUPAC name is 3-(3,3-dimethylmorpholine-4-carbonyl)-N-prop-2-enyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 3-(3,3-dimethylmorpholine-4-carbonyl)-N-prop-2-enyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55984950 |
| Molecular Formula | C23H25F3N2O4S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 3-(3,3-dimethylmorpholine-4-carbonyl)-N-prop-2-enyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | C=CCN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1cccc(C(=O)N2CCOCC2(C)C)c1 |
| InChI | InChI=1S/C23H25F3N2O4S/c1-4-11-28(19-9-6-8-18(15-19)23(24,25)26)33(30,31)20-10-5-7-17(14-20)21(29)27-12-13-32-16-22(27,2)3/h4-10,14-15H,1,11-13,16H2,2-3H3 |
| InChIKey | MVMXHLZUKMEJCU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|