C22H23F3N2O5S — CID 55884354
methyl 3-[methyl-[3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoyl]amino]propanoate (PubChem CID 55884354) has the molecular formula C22H23F3N2O5S and a molecular weight of 484.50 g/mol. Its IUPAC name is methyl 3-[methyl-[3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[methyl-[3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 55884354 |
| Molecular Formula | C22H23F3N2O5S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | methyl 3-[methyl-[3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoyl]amino]propanoate |
| SMILES | C=CCN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1cccc(C(=O)N(C)CCC(=O)OC)c1 |
| InChI | InChI=1S/C22H23F3N2O5S/c1-4-12-27(18-9-6-8-17(15-18)22(23,24)25)33(30,31)19-10-5-7-16(14-19)21(29)26(2)13-11-20(28)32-3/h4-10,14-15H,1,11-13H2,2-3H3 |
| InChIKey | BHNCKJHXQDXQHI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|