C28H25F3N2O5S — CID 2083158
[(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 2083158) has the molecular formula C28H25F3N2O5S and a molecular weight of 558.58 g/mol. Its IUPAC name is [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2083158 |
| Molecular Formula | C28H25F3N2O5S |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | [(2R)-1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | C=CCN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1cccc(C(=O)O[C@H](C)C(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C28H25F3N2O5S/c1-3-15-33(23-11-7-10-22(18-23)28(29,30)31)39(36,37)24-12-6-9-21(17-24)27(35)38-19(2)26(34)32-16-14-20-8-4-5-13-25(20)32/h3-13,17-19H,1,14-16H2,2H3/t19-/m1/s1 |
| InChIKey | GCNQKWHFGYGOMS-LJQANCHMSA-N |
| XLogP | 5.22 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|