C16H15Cl2NO2S2 — CID 100517325
N-(2,5-dichlorophenyl)-4-methylsulfanyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 100517325) has the molecular formula C16H15Cl2NO2S2 and a molecular weight of 388.34 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-methylsulfanyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-methylsulfanyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 100517325 |
| Molecular Formula | C16H15Cl2NO2S2 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-methylsulfanyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1cc(Cl)ccc1Cl)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C16H15Cl2NO2S2/c1-3-10-19(16-11-12(17)4-9-15(16)18)23(20,21)14-7-5-13(22-2)6-8-14/h3-9,11H,1,10H2,2H3 |
| InChIKey | BDJIBMIQSSNFAK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|