C15H11Cl4NO2S — CID 100507490
2,5-dichloro-N-(2,5-dichlorophenyl)-N-prop-2-enylbenzenesulfonamide (PubChem CID 100507490) has the molecular formula C15H11Cl4NO2S and a molecular weight of 411.14 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,5-dichlorophenyl)-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2,5-dichlorophenyl)-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 100507490 |
| Molecular Formula | C15H11Cl4NO2S |
| Molecular Weight | 411.14 g/mol |
| Exact Mass | 408.93 |
| IUPAC Name | 2,5-dichloro-N-(2,5-dichlorophenyl)-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1cc(Cl)ccc1Cl)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H11Cl4NO2S/c1-2-7-20(14-8-10(16)3-5-12(14)18)23(21,22)15-9-11(17)4-6-13(15)19/h2-6,8-9H,1,7H2 |
| InChIKey | LWPSHCJUICKTIN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.14 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|