C16H14BrCl2NO2S — CID 100508195
N-(4-bromo-3-methylphenyl)-2,5-dichloro-N-prop-2-enylbenzenesulfonamide (PubChem CID 100508195) has the molecular formula C16H14BrCl2NO2S and a molecular weight of 435.17 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2,5-dichloro-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2,5-dichloro-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 100508195 |
| Molecular Formula | C16H14BrCl2NO2S |
| Molecular Weight | 435.17 g/mol |
| Exact Mass | 432.93 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2,5-dichloro-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccc(Br)c(C)c1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H14BrCl2NO2S/c1-3-8-20(13-5-6-14(17)11(2)9-13)23(21,22)16-10-12(18)4-7-15(16)19/h3-7,9-10H,1,8H2,2H3 |
| InChIKey | NWNOBPOOVHXJPR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.17 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|