C15H11Cl4NO3S — CID 50895573
2-(4-chloro-N-(2,5-dichlorophenyl)sulfonyl-3-methylanilino)acetyl chloride (PubChem CID 50895573) has the molecular formula C15H11Cl4NO3S and a molecular weight of 427.14 g/mol. Its IUPAC name is 2-(4-chloro-N-(2,5-dichlorophenyl)sulfonyl-3-methylanilino)acetyl chloride.
| Compound Name | 2-(4-chloro-N-(2,5-dichlorophenyl)sulfonyl-3-methylanilino)acetyl chloride |
|---|---|
| PubChem CID | 50895573 |
| Molecular Formula | C15H11Cl4NO3S |
| Molecular Weight | 427.14 g/mol |
| Exact Mass | 424.92 |
| IUPAC Name | 2-(4-chloro-N-(2,5-dichlorophenyl)sulfonyl-3-methylanilino)acetyl chloride |
| SMILES | Cc1cc(N(CC(=O)Cl)S(=O)(=O)c2cc(Cl)ccc2Cl)ccc1Cl |
| InChI | InChI=1S/C15H11Cl4NO3S/c1-9-6-11(3-5-12(9)17)20(8-15(19)21)24(22,23)14-7-10(16)2-4-13(14)18/h2-7H,8H2,1H3 |
| InChIKey | WVBOJXZJXSGWTM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.14 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|