C14H12BrCl2NO2S — CID 100507191
N-(2-bromophenyl)-2,5-dichloro-N-ethylbenzenesulfonamide (PubChem CID 100507191) has the molecular formula C14H12BrCl2NO2S and a molecular weight of 409.13 g/mol. Its IUPAC name is N-(2-bromophenyl)-2,5-dichloro-N-ethylbenzenesulfonamide.
| Compound Name | N-(2-bromophenyl)-2,5-dichloro-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 100507191 |
| Molecular Formula | C14H12BrCl2NO2S |
| Molecular Weight | 409.13 g/mol |
| Exact Mass | 406.91 |
| IUPAC Name | N-(2-bromophenyl)-2,5-dichloro-N-ethylbenzenesulfonamide |
| SMILES | CCN(c1ccccc1Br)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H12BrCl2NO2S/c1-2-18(13-6-4-3-5-11(13)15)21(19,20)14-9-10(16)7-8-12(14)17/h3-9H,2H2,1H3 |
| InChIKey | HAVUCURGYATVBG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.13 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |