C15H13Cl3N2O3S — CID 50895797
2-(3-chloro-N-(2,5-dichlorophenyl)sulfonyl-2-methylanilino)acetamide (PubChem CID 50895797) has the molecular formula C15H13Cl3N2O3S and a molecular weight of 407.71 g/mol. Its IUPAC name is 2-(3-chloro-N-(2,5-dichlorophenyl)sulfonyl-2-methylanilino)acetamide.
| Compound Name | 2-(3-chloro-N-(2,5-dichlorophenyl)sulfonyl-2-methylanilino)acetamide |
|---|---|
| PubChem CID | 50895797 |
| Molecular Formula | C15H13Cl3N2O3S |
| Molecular Weight | 407.71 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | 2-(3-chloro-N-(2,5-dichlorophenyl)sulfonyl-2-methylanilino)acetamide |
| SMILES | Cc1c(Cl)cccc1N(CC(N)=O)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H13Cl3N2O3S/c1-9-11(17)3-2-4-13(9)20(8-15(19)21)24(22,23)14-7-10(16)5-6-12(14)18/h2-7H,8H2,1H3,(H2,19,21) |
| InChIKey | OSABOFRSDHOAHZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |