C27H24N2O4S — CID 2801095
4-methyl-N-[2-[4-[(4-methylphenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 2801095) has the molecular formula C27H24N2O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-methyl-N-[2-[4-[(4-methylphenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[4-[(4-methylphenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 2801095 |
| Molecular Formula | C27H24N2O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 4-methyl-N-[2-[4-[(4-methylphenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccccc1C1=NC(=Cc2ccc(C)cc2)C(=O)O1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H24N2O4S/c1-4-17-29(34(31,32)22-15-11-20(3)12-16-22)25-8-6-5-7-23(25)26-28-24(27(30)33-26)18-21-13-9-19(2)10-14-21/h4-16,18H,1,17H2,2-3H3 |
| InChIKey | FUSMYLUFKRCRHI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|