C25H18Cl2N2O4S — CID 2801089
4-chloro-N-[2-[4-[(2-chlorophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 2801089) has the molecular formula C25H18Cl2N2O4S and a molecular weight of 513.40 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-[(2-chlorophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[2-[4-[(2-chlorophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 2801089 |
| Molecular Formula | C25H18Cl2N2O4S |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 4-chloro-N-[2-[4-[(2-chlorophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccccc1C1=NC(=Cc2ccccc2Cl)C(=O)O1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18Cl2N2O4S/c1-2-15-29(34(31,32)19-13-11-18(26)12-14-19)23-10-6-4-8-20(23)24-28-22(25(30)33-24)16-17-7-3-5-9-21(17)27/h2-14,16H,1,15H2 |
| InChIKey | SUWCOVSVYSIYRX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|