C28H30ClN3O4S — CID 54208143
4-chloro-N-methyl-N-[6-[methyl-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]benzenesulfonamide (PubChem CID 54208143) has the molecular formula C28H30ClN3O4S and a molecular weight of 540.09 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-[6-[methyl-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-methyl-N-[6-[methyl-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54208143 |
| Molecular Formula | C28H30ClN3O4S |
| Molecular Weight | 540.09 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 4-chloro-N-methyl-N-[6-[methyl-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]benzenesulfonamide |
| SMILES | CN(C=C1N=C(c2cccc3ccccc23)OC1=O)CCCCCCN(C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H30ClN3O4S/c1-31(18-7-3-4-8-19-32(2)37(34,35)23-16-14-22(29)15-17-23)20-26-28(33)36-27(30-26)25-13-9-11-21-10-5-6-12-24(21)25/h5-6,9-17,20H,3-4,7-8,18-19H2,1-2H3 |
| InChIKey | PTZUHTKDBXWILR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.09 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|