C27H29N3O4 — CID 54503516
N-methyl-N-[6-[methyl-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]furan-2-carboxamide (PubChem CID 54503516) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-methyl-N-[6-[methyl-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]furan-2-carboxamide.
| Compound Name | N-methyl-N-[6-[methyl-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 54503516 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-methyl-N-[6-[methyl-[(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]furan-2-carboxamide |
| SMILES | CN(C=C1N=C(c2cccc3ccccc23)OC1=O)CCCCCCN(C)C(=O)c1ccco1 |
| InChI | InChI=1S/C27H29N3O4/c1-29(16-7-3-4-8-17-30(2)26(31)24-15-10-18-33-24)19-23-27(32)34-25(28-23)22-14-9-12-20-11-5-6-13-21(20)22/h5-6,9-15,18-19H,3-4,7-8,16-17H2,1-2H3 |
| InChIKey | YECHABCNHOZJHO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|