C27H35N3O4 — CID 70158728
2-methylpropyl N-methyl-N-[6-[methyl-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]carbamate (PubChem CID 70158728) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is 2-methylpropyl N-methyl-N-[6-[methyl-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]carbamate.
| Compound Name | 2-methylpropyl N-methyl-N-[6-[methyl-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 70158728 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 2-methylpropyl N-methyl-N-[6-[methyl-[(E)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]amino]hexyl]carbamate |
| SMILES | CC(C)COC(=O)N(C)CCCCCCN(C)/C=C1/N=C(c2cccc3ccccc23)OC1=O |
| InChI | InChI=1S/C27H35N3O4/c1-20(2)19-33-27(32)30(4)17-10-6-5-9-16-29(3)18-24-26(31)34-25(28-24)23-15-11-13-21-12-7-8-14-22(21)23/h7-8,11-15,18,20H,5-6,9-10,16-17,19H2,1-4H3/b24-18+ |
| InChIKey | IMYKSZANYHMZFU-HKOYGPOVSA-N |
| XLogP | 5.20 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|