C25H21NO6 — CID 993923
[2,6-dimethoxy-4-[(Z)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] propanoate (PubChem CID 993923) has the molecular formula C25H21NO6 and a molecular weight of 431.44 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(Z)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] propanoate.
| Compound Name | [2,6-dimethoxy-4-[(Z)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 993923 |
| Molecular Formula | C25H21NO6 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [2,6-dimethoxy-4-[(Z)-(2-naphthalen-1-yl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(OC)cc(/C=C2\N=C(c3cccc4ccccc34)OC2=O)cc1OC |
| InChI | InChI=1S/C25H21NO6/c1-4-22(27)31-23-20(29-2)13-15(14-21(23)30-3)12-19-25(28)32-24(26-19)18-11-7-9-16-8-5-6-10-17(16)18/h5-14H,4H2,1-3H3/b19-12- |
| InChIKey | CVYNSCCYDAOUTN-UNOMPAQXSA-N |
| XLogP | 4.52 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|