C19H17NO6S — CID 1098975
[2,6-dimethoxy-4-[(E)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] propanoate (PubChem CID 1098975) has the molecular formula C19H17NO6S and a molecular weight of 387.41 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(E)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] propanoate.
| Compound Name | [2,6-dimethoxy-4-[(E)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 1098975 |
| Molecular Formula | C19H17NO6S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [2,6-dimethoxy-4-[(E)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(OC)cc(/C=C2/N=C(c3cccs3)OC2=O)cc1OC |
| InChI | InChI=1S/C19H17NO6S/c1-4-16(21)25-17-13(23-2)9-11(10-14(17)24-3)8-12-19(22)26-18(20-12)15-6-5-7-27-15/h5-10H,4H2,1-3H3/b12-8+ |
| InChIKey | DXCYGNGOUDPBEV-XYOKQWHBSA-N |
| XLogP | 3.43 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|