C16H12BrNO6S2 — CID 2182014
[2-bromo-6-methoxy-4-[(Z)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] methanesulfonate (PubChem CID 2182014) has the molecular formula C16H12BrNO6S2 and a molecular weight of 458.31 g/mol. Its IUPAC name is [2-bromo-6-methoxy-4-[(Z)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] methanesulfonate.
| Compound Name | [2-bromo-6-methoxy-4-[(Z)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 2182014 |
| Molecular Formula | C16H12BrNO6S2 |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 456.93 |
| IUPAC Name | [2-bromo-6-methoxy-4-[(Z)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] methanesulfonate |
| SMILES | COc1cc(/C=C2\N=C(c3cccs3)OC2=O)cc(Br)c1OS(C)(=O)=O |
| InChI | InChI=1S/C16H12BrNO6S2/c1-22-12-8-9(6-10(17)14(12)24-26(2,20)21)7-11-16(19)23-15(18-11)13-4-3-5-25-13/h3-8H,1-2H3/b11-7- |
| InChIKey | SMYNVUGJVZDFKX-XFFZJAGNSA-N |
| XLogP | 3.20 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|