C18H14BrNO4S — CID 2203969
(4E)-4-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 2203969) has the molecular formula C18H14BrNO4S and a molecular weight of 420.28 g/mol. Its IUPAC name is (4E)-4-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2203969 |
| Molecular Formula | C18H14BrNO4S |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | (4E)-4-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | C=CCOc1c(Br)cc(/C=C2/N=C(c3cccs3)OC2=O)cc1OC |
| InChI | InChI=1S/C18H14BrNO4S/c1-3-6-23-16-12(19)8-11(10-14(16)22-2)9-13-18(21)24-17(20-13)15-5-4-7-25-15/h3-5,7-10H,1,6H2,2H3/b13-9+ |
| InChIKey | JDMLKOZAZPCRMF-UKTHLTGXSA-N |
| XLogP | 4.43 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|