C17H15NO6S2 — CID 2184627
[2-ethoxy-4-[(Z)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] methanesulfonate (PubChem CID 2184627) has the molecular formula C17H15NO6S2 and a molecular weight of 393.44 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] methanesulfonate.
| Compound Name | [2-ethoxy-4-[(Z)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 2184627 |
| Molecular Formula | C17H15NO6S2 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | [2-ethoxy-4-[(Z)-(5-oxo-2-thiophen-2-yl-1,3-oxazol-4-ylidene)methyl]phenyl] methanesulfonate |
| SMILES | CCOc1cc(/C=C2\N=C(c3cccs3)OC2=O)ccc1OS(C)(=O)=O |
| InChI | InChI=1S/C17H15NO6S2/c1-3-22-14-10-11(6-7-13(14)24-26(2,20)21)9-12-17(19)23-16(18-12)15-5-4-8-25-15/h4-10H,3H2,1-2H3/b12-9- |
| InChIKey | OLNWBPZPKORFHQ-XFXZXTDPSA-N |
| XLogP | 2.83 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|