C23H19NO4S — CID 1106452
(4Z)-4-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 1106452) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is (4Z)-4-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 1106452 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (4Z)-4-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3cccs3)OC2=O)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C23H19NO4S/c1-15-6-3-4-7-17(15)14-27-19-10-9-16(13-20(19)26-2)12-18-23(25)28-22(24-18)21-8-5-11-29-21/h3-13H,14H2,1-2H3/b18-12- |
| InChIKey | UYIVXYPSXUQQKD-PDGQHHTCSA-N |
| XLogP | 4.99 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|