C22H17NO4S — CID 993914
(4Z)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 993914) has the molecular formula C22H17NO4S and a molecular weight of 391.45 g/mol. Its IUPAC name is (4Z)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 993914 |
| Molecular Formula | C22H17NO4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (4Z)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3cccs3)OC2=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H17NO4S/c1-25-19-13-16(9-10-18(19)26-14-15-6-3-2-4-7-15)12-17-22(24)27-21(23-17)20-8-5-11-28-20/h2-13H,14H2,1H3/b17-12- |
| InChIKey | OUCNKFMDOIPVTJ-ATVHPVEESA-N |
| XLogP | 4.68 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|