C31H25NO4 — CID 3562046
4-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one (PubChem CID 3562046) has the molecular formula C31H25NO4 and a molecular weight of 475.54 g/mol. Its IUPAC name is 4-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3562046 |
| Molecular Formula | C31H25NO4 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 4-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-(2-methylphenyl)-1,3-oxazol-5-one |
| SMILES | Cc1ccccc1C1=NC(=Cc2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)C(=O)O1 |
| InChI | InChI=1S/C31H25NO4/c1-22-10-8-9-15-26(22)30-32-27(31(33)36-30)18-25-16-17-28(34-20-23-11-4-2-5-12-23)29(19-25)35-21-24-13-6-3-7-14-24/h2-19H,20-21H2,1H3 |
| InChIKey | JMMHMAZKKOOENG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|