C30H22BrNO4 — CID 4301445
4-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-(2-bromophenyl)-1,3-oxazol-5-one (PubChem CID 4301445) has the molecular formula C30H22BrNO4 and a molecular weight of 540.41 g/mol. Its IUPAC name is 4-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-(2-bromophenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-(2-bromophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4301445 |
| Molecular Formula | C30H22BrNO4 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 4-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-(2-bromophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2Br)=NC1=Cc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H22BrNO4/c31-25-14-8-7-13-24(25)29-32-26(30(33)36-29)17-23-15-16-27(34-19-21-9-3-1-4-10-21)28(18-23)35-20-22-11-5-2-6-12-22/h1-18H,19-20H2 |
| InChIKey | CUFREIDKOASLEA-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|